3,3-difluoro-1-((4-fluoro-3-((trifluoromethyl)sulfonyl)phenyl)sulfonyl)azetidine
$1,080.00
CAS No.: 2710565-18-5
Catalog No.: 185195
Purity: 95%
MF: C10H7F6NO4S2
MW: 383.291
Storage: 2-8 degree Celsius
SMILES: FC1=C(C=C(C=C1)S(=O)(=O)N1CC(F)(F)C1)S(=O)(=O)C(F)(F)F
Catalog No.: 185195
Purity: 95%
MF: C10H7F6NO4S2
MW: 383.291
Storage: 2-8 degree Celsius
SMILES: FC1=C(C=C(C=C1)S(=O)(=O)N1CC(F)(F)C1)S(=O)(=O)C(F)(F)F
3,3-difluoro-1-((4-fluoro-3-((trifluoromethyl)sulfonyl)phenyl)sulfonyl)azetidine; CAS No.: 2710565-18-5; Specializing in various organic chemicals; ChemShuttle offers 3,3-difluoro-1-((4-fluoro-3-((trifluoromethyl)sulfonyl)phenyl)sulfonyl)azetidine as part of its comprehensive catalog. The company s custom synthesis capabilities allow for the production of complex structures tailored to specific research requirements. As a leading chemicals distributor; ChemShuttle ensures timely delivery and consistent quality, making it a preferred supplier for scientific and industrial applications.
Reviews
Write Your Own Review