![2,2,2-trifluoro-1-((6S,10R)-2-hydroxy-6,7,9,10-tetrahydro-8H-6,10-methanoazepino[4,5-g]quinoxalin-8-yl)ethan-1-one](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/8/187840_2.jpg)
![(6S,10R)-2-methoxy-7,8,9,10-tetrahydro-6H-6,10-methanoazepino[4,5-g]quinoxaline](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/8/187842_2.jpg)
(6S,10R)-1-methyl-1,6,7,8,9,10-hexahydro-2H-6,10-methanoazepino[4,5-g]quinoxalin-2-one
$350.00
CAS No.: 2323525-19-3
Catalog No.: 187841
Purity: 95%
MF: C14H15N3O
MW: 241.294
Storage: 2-8 degree Celsius
SMILES: CN1C(C=NC=2C=C3C(=CC12)[C@@H]1CNC[C@H]3C1)=O
Catalog No.: 187841
Purity: 95%
MF: C14H15N3O
MW: 241.294
Storage: 2-8 degree Celsius
SMILES: CN1C(C=NC=2C=C3C(=CC12)[C@@H]1CNC[C@H]3C1)=O
(6S,10R)-1-methyl-1,6,7,8,9,10-hexahydro-2H-6,10-methanoazepino[4,5-g]quinoxalin-2-one,CAS No.: 2323525-19-3 - This building block is essential in the synthesis of heterocyclic compounds used in the pharmaceutical industry. Its downstream applications include the production of antiviral and antibacterial drugs. The compound's high reactivity and compatibility with various chemical reactions are key benefits, facilitating its use in drug development.
Reviews
Write Your Own Review