8-fluoroquinoline-6-carboxylic acid
$400.00
CAS No.: 1061650-25-6
Catalog No.: 192190
Purity: 95%
MF: C10H6FNO2
MW: 191.161
Storage: 2-8 degree Celsius
SMILES: FC=1C=C(C=C2C=CC=NC12)C(=O)O
Catalog No.: 192190
Purity: 95%
MF: C10H6FNO2
MW: 191.161
Storage: 2-8 degree Celsius
SMILES: FC=1C=C(C=C2C=CC=NC12)C(=O)O
8-fluoroquinoline-6-carboxylic acid; CAS No.: 1061650-25-6; 8-fluoroquinoline-6-carboxylic acid. PROPERTIES: 8-fluoroquinoline-6-carboxylic acid is a crystalline substance with molecular weight 190.16 g/mol. It has a melting point of approximately 240-245 C (decomposition) and exhibits limited solubility in water but dissolves in hot acetic acid. The compound is light-sensitive and should be stored in amber containers at 2-8 C. Safety considerations include wearing respiratory protection during handling due to its potential to cause respiratory tract irritation, along with standard lab PPE. APPLICATIONS: This fluorinated quinoline derivative is used in the development of antimalarial agents. The fluorine substitution at position 8 enhances binding to plasmodial enzymes as described in tropical medicine research. Additionally, 8-fluoroquinoline-6-carboxylic acid serves as a precursor in the synthesis of fluorescent DNA intercalators. According to biochemical journals, the carboxylic acid group allows for conjugation with targeting moieties, directing the quinoline scaffold to specific genomic regions for imaging applications.
Reviews
Write Your Own Review