3,6-dibromo-1,4-dimethylquinolin-2(1H)-one
$250.00
CAS No.: 2417419-28-2
Catalog No.: 192524
Purity: 95%
MF: C11H9Br2NO
MW: 331.007
Storage: 2-8 degree Celsius
SMILES: BrC=1C(N(C2=CC=C(C=C2C1C)Br)C)=O
Catalog No.: 192524
Purity: 95%
MF: C11H9Br2NO
MW: 331.007
Storage: 2-8 degree Celsius
SMILES: BrC=1C(N(C2=CC=C(C=C2C1C)Br)C)=O
3,6-dibromo-1,4-dimethylquinolin-2(1H)-one; CAS No.: 2417419-28-2; 3,6-dibromo-1,4-dimethylquinolin-2(1H)-one. PROPERTIES: 3,6-dibromo-1,4-dimethylquinolin-2(1H)-one is a crystalline powder with molecular formula C10H8Br2N2O. It has a melting point between 220-225 C and exhibits limited solubility in common organic solvents. The compound is light-sensitive and should be stored in amber glassware at 2-8 C. Safety precautions include wearing protective clothing due to its potential to cause skin burns and using explosion-proof ventilation due to its explosive nature when exposed to heat. APPLICATIONS: This dibrominated, dimethyl-substituted quinolinone is employed in the development of antimicrobial agents. The quinolinone structure provides critical interactions with bacterial targets as reported in pharmaceutical chemistry journals. In materials science, 3,6-dibromo-1,4-dimethylquinolin-2(1H)-one derivatives have found use in creating self-assembled monolayers for surface modification. According to materials chemistry journals, the quinolinone core promotes adsorption onto metal surfaces while the bromine substituents impart chemical resistance.
Reviews
Write Your Own Review