1-(3-bromoquinolin-7-yl)ethanone
$350.00
CAS No.: 1956331-82-0
Catalog No.: 192027
Purity: 95%
MF: C11H8BrNO
MW: 250.095
Storage: 2-8 degree Celsius
SMILES: BrC=1C=NC2=CC(=CC=C2C1)C(C)=O
Catalog No.: 192027
Purity: 95%
MF: C11H8BrNO
MW: 250.095
Storage: 2-8 degree Celsius
SMILES: BrC=1C=NC2=CC(=CC=C2C1)C(C)=O
1-(3-bromoquinolin-7-yl)ethanone; CAS No.: 1956331-82-0; 1-(3-bromoquinolin-7-yl)ethanone. PROPERTIES: 1-(3-bromoquinolin-7-yl)ethanone is a solid compound with a molecular weight of 257.1 g/mol. It has a melting point ranging from 102 to 105 C and is moderately soluble in polar organic solvents such as methanol and acetone. The compound is sensitive to light and should be stored in amber glass containers. It is stable under normal laboratory conditions but may decompose upon exposure to strong acids or bases. When handling, protective eyewear and gloves should be worn, and in case of accidental ingestion, immediate medical attention is required. APPLICATIONS: 1-(3-bromoquinolin-7-yl)ethanone functions as a versatile intermediate in the synthesis of pharmaceuticals, particularly in the development of anticancer and antiviral agents. The bromine substituent allows for diverse substitution reactions, while the ketone group provides additional reactivity. In medicinal chemistry, 1-(3-bromoquinolin-7-yl)ethanone is used to create compounds with improved pharmacokinetic profiles. It also serves as a building block in the synthesis of fluorescent dyes, where its quinoline core contributes to emission characteristics. Additionally, the compound is employed in the preparation of coordination compounds with metal ions for catalytic applications in organic transformations. These applications are typically encountered in pharmaceutical R&D departments and specialized chemical synthesis laboratories.
Reviews
Write Your Own Review