![(3R,4S)-1-[(tert-butoxy)carbonyl]-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/6/168084_1.jpg)
tert-butyl N-[(3R,4R)-4-fluoropyrrolidin-3-yl]carbamate hydrochloride
$996.00
CAS No.: 2097061-04-4
Catalog No.: 190104
Purity: 95%
MF: C9H17FN2O2
MW: 204.245
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N[C@@H]1CNC[C@H]1F
Catalog No.: 190104
Purity: 95%
MF: C9H17FN2O2
MW: 204.245
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N[C@@H]1CNC[C@H]1F
tert-butyl N-[(3R,4R)-4-fluoropyrrolidin-3-yl]carbamate hydrochloride; CAS No.: 2097061-04-4; tert-butyl N-[(3R,4R)-4-fluoropyrrolidin-3-yl]carbamate hydrochloride exemplifies the protected pyrrolidine derivatives category within Chem Shuttle's product offerings. As a chemical synthesis company, Chem Shuttle provides access to carbamate-protected amines that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its tert-butyl carbamate and chiral pyrrolidine groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's online platform allows researchers to conveniently procure such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in small molecules synthesis ensures that tert-butyl N-[(3R,4R)-4-fluoropyrrolidin-3-yl]carbamate hydrochloride is available in high purity and with precise specifications, making it a reliable tool for synthetic chemists.
Reviews
Write Your Own Review