![4-amino-1-[(2-chlorophenyl)methyl]pyrrolidin-2-one](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171632_1.jpg)
tert-butyl 3-(1-amino-2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate
$180.00
CAS No.: 1135916-70-9
Catalog No.: 171616
Purity: 95%
MF: C12H22N2O4
MW: 258.318
Storage: 2-8 degree Celsius
SMILES: COC(=O)C(N)C1CCN(C1)C(=O)OC(C)(C)C
Catalog No.: 171616
Purity: 95%
MF: C12H22N2O4
MW: 258.318
Storage: 2-8 degree Celsius
SMILES: COC(=O)C(N)C1CCN(C1)C(=O)OC(C)(C)C
tert-butyl 3-(1-amino-2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate; CAS No.: 1135916-70-9; tert-butyl 3-(1-amino-2-methoxy-2-oxoethyl)pyrrolidine-1-carboxylate is a pharma building block offered by ChemShuttle, a leading chemicals distributor. It participates in CRO chemical synthesis, serving as a valuable component in small molecules synthesis. The pyrrolidine ring with the protected amino and the amido - ester group offers multiple sites for chemical reactions. In custom synthesis, it can be used to build more complex molecules, which may have potential applications in the pharmaceutical industry. Its structure makes it a key intermediate in the synthesis of drug - like compounds.
Reviews
Write Your Own Review