(2S,4R)-4-fluoropyrrolidine-2-carboxylic acid hydrochloride
$245.00
CAS No.: 60604-36-6
Catalog No.: 170156
Purity: 95%
MF: C5H9ClFNO2
MW: 169.583
Storage: 2-8 degree Celsius
SMILES: Cl.OC(=O)[C@@H]1C[C@@H](F)CN1
Catalog No.: 170156
Purity: 95%
MF: C5H9ClFNO2
MW: 169.583
Storage: 2-8 degree Celsius
SMILES: Cl.OC(=O)[C@@H]1C[C@@H](F)CN1
(2S,4R)-4-fluoropyrrolidine-2-carboxylic acid hydrochloride; CAS No.: 60604-36-6; (2S,4R)-4-fluoropyrrolidine-2-carboxylic acid hydrochloride exemplifies ChemShuttle's chem blocks for drug discovery. As a custom synthesis company, we provide enantiomerically pure compounds crucial for developing chiral pharmaceuticals. This fluorinated pyrrolidine derivative serves as a building block for creating bioactive molecules with optimized pharmacokinetic profiles. ChemShuttle's chemical synthesis expertise ensures precise stereochemistry and high purity, making this compound ideal for medicinal chemists exploring novel therapeutic agents. OurLibrary of Compounds includes numerous chiral amines and carboxylic acids to accelerate research progress.
Reviews
Write Your Own Review