(2R,3S)-3-hydroxypyrrolidine-2-carboxylic acid hydrochloride
$245.00
CAS No.: 468061-05-4
Catalog No.: 170273
Purity: 95%
MF: C5H10ClNO3
MW: 167.592
Storage: 2-8 degree Celsius
SMILES: Cl.O[C@H]1CCN[C@H]1C(O)=O
Catalog No.: 170273
Purity: 95%
MF: C5H10ClNO3
MW: 167.592
Storage: 2-8 degree Celsius
SMILES: Cl.O[C@H]1CCN[C@H]1C(O)=O
(2R,3S)-3-hydroxypyrrolidine-2-carboxylic acid hydrochloride; CAS No.: 468061-05-4; (2R,3S)-3-hydroxypyrrolidine-2-carboxylic acid hydrochloride illustrates ChemShuttle's chem blocks collection. As a custom chemical synthesis company, we offer chiral pyrrolidine derivatives with hydroxyl and carboxylic acid functionality for research. This compound combines hydroxyl substitution with a carboxylic acid group on a pyrrolidine ring with defined configuration, providing unique steric properties. ChemShuttle's chemical synthesis expertise ensures precise stereochemistry and high purity. The hydrochloride salt form ensures stability and solubility, making this compound valuable in peptide synthesis and medicinal chemistry.
Reviews
Write Your Own Review