![dimethyl[(2R)-pyrrolidin-2-ylmethyl]amine](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171562_1.jpg)
1-[(tert-butoxy)carbonyl]-3-cyanopyrrolidine-3-carboxylic acid
$285.00
CAS No.: 1158759-28-4
Catalog No.: 171589
Purity: 95%
MF: C11H16N2O4
MW: 240.259
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCC(C1)(C#N)C(O)=O
Catalog No.: 171589
Purity: 95%
MF: C11H16N2O4
MW: 240.259
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCC(C1)(C#N)C(O)=O
1-[(tert-butoxy)carbonyl]-3-cyanopyrrolidine-3-carboxylic acid; CAS No.: 1158759-28-4; 1-[(tert-butoxy)carbonyl]-3-cyanopyrrolidine-3-carboxylic acid is a cycle compound from ChemShuttle, a chemical online store. It acts as a key intermediate in small molecules synthesis. The pyrrolidine ring with the cyano and protected carboxylic acid groups provides a rich platform for chemical reactions. In custom synthesis, it can be used to build more complex molecules by exploiting the reactivity of these functional groups. This compound is essential for constructing molecules with specific chemical and biological properties.
Reviews
Write Your Own Review