1-benzyl-5-oxo-pyrrolidine-3-carboxylic acid
$350.00
CAS No.: 5733-86-8
Catalog No.: 109182
Purity: 95%
MF: C12H13NO3
MW: 219.24
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1CN(CC2=CC=CC=C2)C(=O)C1
Catalog No.: 109182
Purity: 95%
MF: C12H13NO3
MW: 219.24
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1CN(CC2=CC=CC=C2)C(=O)C1
1-benzyl-5-oxo-pyrrolidine-3-carboxylic acid; CAS No.: 5733-86-8; 1-benzyl-5-oxo-pyrrolidine-3-carboxylic acid is part of ChemShuttle's building blocks for drug discovery offerings. This classification highlights its role as a foundational element in the synthesis of potential pharmaceutical compounds. As a building block for drug discovery, this pyrrolidine derivative provides medicinal chemists with a specific molecular structure that can be modified and incorporated into drug candidates. ChemShuttle's focus on high-quality building blocks for drug discovery ensures that products like 1-benzyl-5-oxo-pyrrolidine-3-carboxylic acid meet the stringent purity and specification standards required for pharmaceutical research. The compound's CAS No.: 5733-86-8 allows researchers to accurately identify and source this specific building block. By supplying such compounds, ChemShuttle supports the early stages of drug development, enabling scientists to efficiently create and evaluate new chemical entities with potential therapeutic applications.
Reviews
Write Your Own Review