1-benzyl 2-methyl (2S,4S)-4-aminopyrrolidine-1,2-dicarboxylate hydrochloride
$800.00
CAS No.: 1515919-15-9
Catalog No.: 187691
Purity: 95%
MF: C14H19ClN2O4
MW: 314.769
Storage: 2-8 degree Celsius
SMILES: Cl.N[C@H]1C[C@H](N(C1)C(=O)OCC1=CC=CC=C1)C(=O)OC
Catalog No.: 187691
Purity: 95%
MF: C14H19ClN2O4
MW: 314.769
Storage: 2-8 degree Celsius
SMILES: Cl.N[C@H]1C[C@H](N(C1)C(=O)OCC1=CC=CC=C1)C(=O)OC
1-benzyl 2-methyl (2S,4S)-4-aminopyrrolidine-1,2-dicarboxylate hydrochloride; CAS No.: 1515919-15-9; ChemShuttle's collection includes 1-benzyl 2-methyl (2S,4S)-4-aminopyrrolidine-1,2-dicarboxylate hydrochloride, which is a valuable building block for pharmaceutical development. As a custom chemical synthesis company, it provides various organic chemicals and cycle compounds. Its library of heterocycles and key intermediates serves as essential chem blocks for drug discovery, allowing researchers to access the necessary compounds for their projects.
Reviews
Write Your Own Review