(E)-methyl 4-(3-(dimethylamino)-2-methylacryloyl)-1-tosyl-1H-pyrrole-2-carboxylate
$285.00
CAS No.: 1191272-70-4
Catalog No.: 199098
Purity: 95%
MF: C19H22N2O5S
MW: 390.461
Storage: 2-8 degree Celsius
SMILES: CN(/C=C(/C(=O)C=1C=C(N(C1)S(=O)(=O)C1=CC=C(C)C=C1)C(=O)OC)\C)C
Catalog No.: 199098
Purity: 95%
MF: C19H22N2O5S
MW: 390.461
Storage: 2-8 degree Celsius
SMILES: CN(/C=C(/C(=O)C=1C=C(N(C1)S(=O)(=O)C1=CC=C(C)C=C1)C(=O)OC)\C)C
CAS No.: 1191272-70-4; Offering (E)-methyl 4-(3-(dimethylamino)-2-methylacryloyl)-1-tosyl-1H-pyrrole-2-carboxylate as part of our blocks chemistry portfolio, ChemShuttle supports the creation of fluorescent probes and sensor molecules. This acryloyl-functionalized pyrrole, with CAS No.: 1191272-70-4, is crucial for photodynamic therapy and imaging applications. ChemShuttle ensures that (E)-methyl 4-(3-(dimethylamino)-2-methylacryloyl)-1-tosyl-1H-pyrrole-2-carboxylate (CAS No.: 1191272-70-4) is synthesized with strict quality controls, providing reliable performance in research. The compound's unique E-configuration, referenced by CAS No.: 1191272-70-4, allows for precise molecular design. As a chemical synthesis companies leader, we facilitate access to innovative building blocks. This product exemplifies ChemShuttle's dedication to enabling scientific breakthroughs through high-quality intermediates.
Reviews
Write Your Own Review