phenyl(pyrimidin-2-yl)methanone
$360.00
CAS No.: 112170-34-0
Catalog No.: 188566
Purity: 95%
MF: C11H8N2O
MW: 184.198
Storage: 2-8 degree Celsius
SMILES: C1(=CC=CC=C1)C(=O)C1=NC=CC=N1
Catalog No.: 188566
Purity: 95%
MF: C11H8N2O
MW: 184.198
Storage: 2-8 degree Celsius
SMILES: C1(=CC=CC=C1)C(=O)C1=NC=CC=N1
phenyl(pyrimidin-2-yl)methanone; CAS No.: 112170-34-0; Building blocks for drug discovery, like phenyl(pyrimidin-2-yl)methanone, are a cornerstone of ChemShuttle's chemical synthesis services. As a custom chemical synthesis company, we provide access to a diverse array of compounds that are crucial for developing new pharmaceuticals. Our chemical online mall offers researchers the opportunity to obtain specialized chemicals that can react with various biological targets, potentially leading to the identification of new lead compounds. This particular compound demonstrates our ability to synthesize molecules with multiple functional groups that can be further elaborated to enhance their drug-like properties. By supplying such building blocks, ChemShuttle supports the scientific community in their pursuit of innovative therapies and contributes to the advancement of medical science.
Reviews
Write Your Own Review