5-bromo-2-chloro-N-cyclopentylpyrimidin-4-amine
$350.00
CAS No.: 733039-20-8
Catalog No.: 133843
Purity: 95%
MF: C9H11BrClN3
MW: 276.565
Storage: 2-8 degree Celsius
SMILES: ClC1=NC(NC2CCCC2)=C(Br)C=N1
Catalog No.: 133843
Purity: 95%
MF: C9H11BrClN3
MW: 276.565
Storage: 2-8 degree Celsius
SMILES: ClC1=NC(NC2CCCC2)=C(Br)C=N1
5-bromo-2-chloro-N-cyclopentylpyrimidin-4-amine; CAS No.: 733039-20-8; 5-bromo-2-chloro-N-cyclopentylpyrimidin-4-amine exemplifies ChemShuttle's diverse product range as a custom chemical synthesis company specializing in halogenated building blocks. This key intermediates compound serves as a valuable starting material for developing new pharmaceutical agents with unique pharmacological profiles. Our chemical synthesis companies provide reliable access to high-purity bromo-chlorinated pyrimidine derivatives essential for modern medicinal chemistry. The cyclopentylamine group enables diverse bioconjugation reactions, supporting CRO chemical synthesis projects in constructing complex molecular frameworks. As a worldwide chemical supplier, ChemShuttle ensures consistent quality and timely delivery, making this compound ideal for Small molecules synthesis and facilitating efficient drug discovery processes across diverse research environments.
Reviews
Write Your Own Review