4,6-dichloro-2-(methylsulfonyl)pyrimidine
$300.00
CAS No.: 4489-34-3
Catalog No.: 189170
Purity: 95%
MF: C5H4Cl2N2O2S
MW: 227.072
Storage: 2-8 degree Celsius
SMILES: ClC1=NC(=NC(=C1)Cl)S(=O)(=O)C
Catalog No.: 189170
Purity: 95%
MF: C5H4Cl2N2O2S
MW: 227.072
Storage: 2-8 degree Celsius
SMILES: ClC1=NC(=NC(=C1)Cl)S(=O)(=O)C
4,6-dichloro-2-(methylsulfonyl)pyrimidine; CAS No.: 4489-34-3; 4,6-dichloro-2-(methylsulfonyl)pyrimidine exemplifies the chloropyrimidines category within Chem Shuttle's product offerings. As a chemical online store, Chem Shuttle provides access to pyrimidine derivatives with chloro and methylsulfonyl substituents that are crucial for the development of various pharmaceuticals and agrochemicals with enhanced biological activities. This compound, with its dichloro and methylsulfonyl groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific receptors. Chem Shuttle's custom synthesis services allow for the production of such specialized pyrimidines to exact specifications, supporting the discovery of novel therapeutic agents. The company's expertise in cycle compounds ensures that researchers can obtain high-purity 4,6-dichloro-2-(methylsulfonyl)pyrimidine, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review