(3-(5-((1-methylpiperidin-4-yl)methoxy)pyrimidin-2-yl)phenyl)methanol
$350.00
CAS No.: 1100598-48-8
Catalog No.: 171647
Purity: 95%
MF: C18H23N3O2
MW: 313.401
Storage: 2-8 degree Celsius
SMILES: CN1CCC(COC2=CN=C(N=C2)C2=CC=CC(CO)=C2)CC1
Catalog No.: 171647
Purity: 95%
MF: C18H23N3O2
MW: 313.401
Storage: 2-8 degree Celsius
SMILES: CN1CCC(COC2=CN=C(N=C2)C2=CC=CC(CO)=C2)CC1
(3-(5-((1-methylpiperidin-4-yl)methoxy)pyrimidin-2-yl)phenyl)methanol; CAS No.: 1100598-48-8; (3-(5-((1-methylpiperidin-4-yl)methoxy)pyrimidin-2-yl)phenyl)methanol is a heterocycle and a chem block. ChemShuttle, a worldwide chemical supplier, offers this compound, which can be employed in custom synthesis. Its heterocyclic structure and multiple functional groups make it a versatile component in chemical reactions. It can be used to build more complex molecules, which may have applications in drug discovery, material science, and other areas of chemical research, facilitating the creation of new chemical substances with specific properties.
Reviews
Write Your Own Review