2-chloro-5-nitropyrimidine
$180.00
CAS No.: 10320-42-0
Catalog No.: 101784
Purity: 95%
MF: C4H2ClN3O2
MW: 159.532
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)C1=CN=C(Cl)N=C1
Catalog No.: 101784
Purity: 95%
MF: C4H2ClN3O2
MW: 159.532
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)C1=CN=C(Cl)N=C1
2-chloro-5-nitropyrimidine; CAS No.: 10320-42-0; ChemShuttle, a chemical synthesis company, provides access to various organic chemicals like 2-chloro-5-nitropyrimidine. As a custom synthesis company, it specializes in creating tailored solutions that meet specific research requirements. The company's expertise in chemical building blocks makes it a valuable resource for scientists seeking to advance their studies.
Reviews
Write Your Own Review