2-chloro-5-nitro-N-(prop-2-yn-1-yl)pyrimidin-4-amine
$750.00
CAS No.: 1695701-05-3
Catalog No.: 181834
Purity: 95%
MF: C7H5ClN4O2
MW: 212.596
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)C1=C(NCC#C)N=C(Cl)N=C1
Catalog No.: 181834
Purity: 95%
MF: C7H5ClN4O2
MW: 212.596
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)C1=C(NCC#C)N=C(Cl)N=C1
2-chloro-5-nitro-N-(prop-2-yn-1-yl)pyrimidin-4-amine; CAS No.: 1695701-05-3; ChemShuttle is a trusted custom synthesis company, providing high-quality Bioactive compounds. These compounds are designed to interact with biological systems, making them essential for pharmaceutical and biotechnology research. Our advanced synthesis techniques and rigorous quality control ensure the highest standards of purity and efficacy.
Reviews
Write Your Own Review