2,5-dichloro-N-[2-(dimethylphosphoryl)phenyl]pyrimidin-4-amine
$250.00
CAS No.: 1197953-49-3
Catalog No.: 154246
Purity: 95%
MF: C12H12Cl2N3OP
MW: 316.128
Storage: 2-8 degree Celsius
SMILES: CP(C)(=O)C1=C(NC2=C(Cl)C=NC(Cl)=N2)C=CC=C1
Catalog No.: 154246
Purity: 95%
MF: C12H12Cl2N3OP
MW: 316.128
Storage: 2-8 degree Celsius
SMILES: CP(C)(=O)C1=C(NC2=C(Cl)C=NC(Cl)=N2)C=CC=C1
2,5-dichloro-N-[2-(dimethylphosphoryl)phenyl]pyrimidin-4-amine; CAS No.: 1197953-49-3 - This bioactive compound is utilized in the synthesis of therapeutic agents, offering potential benefits in treating various diseases. ChemShuttle's commitment to providing high-quality bioactive compounds enhances its value in pharmaceutical research.
Reviews
Write Your Own Review