2-chloro-6-nitropyridine
$300.00
CAS No.: 94166-64-0
Catalog No.: 106564
Purity: 95%
MF: C5H3ClN2O2
MW: 158.544
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)C1=CC=CC(Cl)=N1
Catalog No.: 106564
Purity: 95%
MF: C5H3ClN2O2
MW: 158.544
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)C1=CC=CC(Cl)=N1
2-chloro-6-nitropyridine; CAS No.: 94166-64-0; 2-chloro-6-nitropyridine is part of our various organic chemicals portfolio. Operating as a chemical synthesis company, ChemShuttle delivers high-performance compounds with consistent quality, enabling breakthroughs in synthetic chemistry applications.
Reviews
Write Your Own Review