tert-butyl (3,6-dichloropyridazin-4-yl)carbamate
$300.00
CAS No.: 887310-61-4
Catalog No.: 137098
Purity: 95%
MF: C9H11Cl2N3O2
MW: 264.112
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)NC1=C(Cl)N=NC(Cl)=C1
Catalog No.: 137098
Purity: 95%
MF: C9H11Cl2N3O2
MW: 264.112
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)NC1=C(Cl)N=NC(Cl)=C1
tert-butyl (3,6-dichloropyridazin-4-yl)carbamate; CAS No.: 887310-61-4; ChemShuttle functions as a chemical synthesis company specializing in carbamate derivatives such as tert-butyl (3,6-dichloropyridazin-4-yl)carbamate (CAS No.: 887310-61-4). This compound exemplifies the company's focus on offering building blocks for drug discovery with protecting groups. As a chemical synthesis company, ChemShuttle offers various organic chemicals that serve as essential intermediates in pharmaceutical research. The dichloro substitution and tert-butyl carbamate group in CAS No.: 887310-61-4 add to its structural diversity, making it valuable in custom synthesis projects. Researchers benefit from ChemShuttle's chemical synthesis company services when sourcing such specialized screening compounds, which are often critical for advancing drug discovery initiatives. The company's expertise in chemical synthesis ensures that compounds like this pyridazinyl carbamate derivative meet the high standards required for research applications.
Reviews
Write Your Own Review