5-amino-2-phenylpyridazin-3(2H)-one
$300.00
CAS No.: 13589-77-0
Catalog No.: 137084
Purity: 95%
MF: C10H9N3O
MW: 187.202
Storage: 2-8 degree Celsius
SMILES: NC1=CC(=O)N(N=C1)C1=CC=CC=C1
Catalog No.: 137084
Purity: 95%
MF: C10H9N3O
MW: 187.202
Storage: 2-8 degree Celsius
SMILES: NC1=CC(=O)N(N=C1)C1=CC=CC=C1
5-amino-2-phenylpyridazin-3(2H)-one; CAS No.: 13589-77-0; ChemShuttle functions as a chemical synthesis company specializing in aminophenylpyridazinone derivatives such as 5-amino-2-phenylpyridazin-3(2H)-one (CAS No.: 13589-77-0). This compound exemplifies the company's focus on offering building blocks for drug discovery with amine and phenyl substituents. As a chemical synthesis company, ChemShuttle offers various organic chemicals that serve as essential intermediates in pharmaceutical research. The amino and phenyl groups in CAS No.: 13589-77-0 add to its structural diversity, making it valuable in custom synthesis projects. Researchers benefit from ChemShuttle's chemical synthesis company services when sourcing such specialized screening compounds, which are often critical for advancing drug discovery initiatives. The company's expertise in chemical synthesis ensures that compounds like this pyridazinone derivative meet the high standards required for research applications.
Reviews
Write Your Own Review