4-amino-5-nitropyridazin-3-ol
$180.00
CAS No.: 6381-47-1
Catalog No.: 137041
Purity: 95%
MF: C4H4N4O3
MW: 156.101
Storage: 2-8 degree Celsius
SMILES: NC1=C(O)N=NC=C1[N+]([O-])=O
Catalog No.: 137041
Purity: 95%
MF: C4H4N4O3
MW: 156.101
Storage: 2-8 degree Celsius
SMILES: NC1=C(O)N=NC=C1[N+]([O-])=O
4-amino-5-nitropyridazin-3-ol; CAS No.: 6381-47-1; ChemShuttle functions as a chemical synthesis company specializing in amino-nitropyridazinol derivatives such as 4-amino-5-nitropyridazin-3-ol (CAS No.: 6381-47-1). This compound exemplifies the company's focus on offering building blocks for drug discovery with diverse functional groups. As a chemical synthesis company, ChemShuttle offers various organic chemicals that serve as essential intermediates in pharmaceutical research. The amino and nitro groups in CAS No.: 6381-47-1 add to its structural diversity, making it valuable in custom synthesis projects. Researchers benefit from ChemShuttle's chemical synthesis company services when sourcing such specialized screening compounds, which are often critical for advancing drug discovery initiatives. The company's expertise in chemical synthesis ensures that compounds like this pyridazinol derivative meet the high standards required for research applications.
Reviews
Write Your Own Review