![3-bromopyrazolo[1,5-a]pyrimidine-6-carboxylic acid](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171223_1.jpg)
![5-chloropyrazolo[1,5-a]pyrimidin-3-amine](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171358_1.jpg)
ethyl 3-bromopyrazolo[1,5-a]pyrimidine-6-carboxylate
$255.00
CAS No.: 1263060-07-6
Catalog No.: 171239
Purity: 95%
MF: C9H8BrN3O2
MW: 270.086
Storage: 2-8 degree Celsius
SMILES: CCOC(=O)C1=CN2N=CC(Br)=C2N=C1
Catalog No.: 171239
Purity: 95%
MF: C9H8BrN3O2
MW: 270.086
Storage: 2-8 degree Celsius
SMILES: CCOC(=O)C1=CN2N=CC(Br)=C2N=C1
ethyl 3-bromopyrazolo[1,5-a]pyrimidine-6-carboxylate; CAS No.: 1263060-07-6; ethyl 3-bromopyrazolo[1,5-a]pyrimidine-6-carboxylate is a screening compound provided by ChemShuttle, a chemical synthesis company. This heterocyclic compound is valuable in screening processes for new chemical entities. The company offers small molecules synthesis services, allowing for the production of this screening compound in the appropriate quantities. ChemShuttle's role as a chemical synthesis company ensures the quality and reliability of the screening compounds it supplies, supporting the discovery of novel chemical substances.
Reviews
Write Your Own Review