![1-(tert-butyl)-1H-pyrazolo[3,4-d]pyrimidine-3,4-diol](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/9/199627_1.jpg)
![1-(tert-butyl)-4,6-dichloro-1H-pyrazolo[3,4-d]pyrimidine](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/9/199650_1.jpg)
4-amino-1-(tert-butyl)-1H-pyrazolo[3,4-d]pyrimidin-3-ol
$285.00
CAS No.: 1151651-82-9
Catalog No.: 199647
Purity: 95%
MF: C9H13N5O
MW: 207.237
Storage: 2-8 degree Celsius
SMILES: NC1=C2C(=NC=N1)N(N=C2O)C(C)(C)C
Catalog No.: 199647
Purity: 95%
MF: C9H13N5O
MW: 207.237
Storage: 2-8 degree Celsius
SMILES: NC1=C2C(=NC=N1)N(N=C2O)C(C)(C)C
CAS No.: 1151651-82-9; ChemShuttle, as a leading chemical synthesis company, specializes in providing diverse screening compounds for research purposes. The compound 4-amino-1-(tert-butyl)-1H-pyrazolo[3,4-d]pyrimidin-3-ol (CAS No.: 1151651-82-9) exemplifies their commitment to offering high-quality chemical building blocks. These screening compounds are essential for various scientific investigations, enabling researchers to explore new avenues in drug discovery and chemical research. ChemShuttle's extensive library of compounds includes numerous heterocycles and organic chemicals, making them a valuable resource for scientists worldwide. The 4-amino-1-(tert-butyl)-1H-pyrazolo[3,4-d]pyrimidin-3-ol is just one of the many building blocks for drug discovery that ChemShuttle provides, highlighting their role as a key player in the chemical synthesis industry. Researchers can rely on ChemShuttle's screening compounds to advance their studies, knowing that each compound undergoes rigorous quality control. With a focus on delivering reliable chemical building blocks, ChemShuttle continues to support innovation in the scientific community through their diverse product offerings.
Reviews
Write Your Own Review