![methyl 1H-pyrazolo[4,3-c]pyridine-4-carboxylate](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171613_1.jpg)
![1,2,4,5,6,7-hexahydro-3H-pyrazolo[3,4-c]pyridin-3-one hydrochloride](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171915_1.jpg)
5-bromopyrazolo[1,5-a]pyridine-3-carboxylic acid
$295.00
CAS No.: 1101121-05-4
Catalog No.: 171645
Purity: 95%
MF: C8H5BrN2O2
MW: 241.044
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=C2C=C(Br)C=CN2N=C1
Catalog No.: 171645
Purity: 95%
MF: C8H5BrN2O2
MW: 241.044
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=C2C=C(Br)C=CN2N=C1
5-bromopyrazolo[1,5-a]pyridine-3-carboxylic acid; CAS No.: 1101121-05-4; 5-bromopyrazolo[1,5-a]pyridine-3-carboxylic acid is a heterocycle and a key intermediate. ChemShuttle, a custom chemical synthesis company, offers this compound, providing opportunities for custom synthesis. Its heterocyclic structure and carboxylic acid group make it a valuable asset in constructing more complex molecules. It can be involved in the synthesis of various chemical products, including pharmaceuticals and agrochemicals, helping researchers create new and innovative chemical entities with specific functions.
Reviews
Write Your Own Review