(S)-3-phenyl-2-(pyrazine-2-carboxamido)propanoic acid
$350.00
CAS No.: 114457-94-2
Catalog No.: 102043
Purity: 95%
MF: C14H13N3O3
MW: 271.276
Storage: 2-8 degree Celsius
SMILES: OC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C1=NC=CN=C1
Catalog No.: 102043
Purity: 95%
MF: C14H13N3O3
MW: 271.276
Storage: 2-8 degree Celsius
SMILES: OC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C1=NC=CN=C1
(S)-3-phenyl-2-(pyrazine-2-carboxamido)propanoic acid; CAS No.: 114457-94-2; ChemShuttle is a chemical synthesis company that deals with (S)-3-phenyl-2-(pyrazine-2-carboxamido)propanoic acid, which is classified as a chemical building block. This compound is a key intermediate used in the development of pharmaceuticals and other chemical applications. The company specializes in custom synthesis services, allowing researchers to request specific compounds tailored to their research needs. As a worldwide chemical supplier, ChemShuttle provides a vast array of chemical building blocks essential for constructing complex molecules. Its Library of Compounds ensures that customers have access to a diverse selection of intermediates necessary for drug discovery and chemical research.
Reviews
Write Your Own Review