6-(4-(2,4-difluorophenoxy)piperidin-1-yl)-5-(isopropylamino)pyrazine-2-carboxylic acid
$0.00
CAS No.: 1803121-23-4
Catalog No.: 199994
Purity: 95%
MF: C19H22F2N4O3
MW: 392.406
Storage: 2-8 degree Celsius
SMILES: FC1=C(OC2CCN(CC2)C2=C(N=CC(=N2)C(=O)O)NC(C)C)C=CC(=C1)F
Catalog No.: 199994
Purity: 95%
MF: C19H22F2N4O3
MW: 392.406
Storage: 2-8 degree Celsius
SMILES: FC1=C(OC2CCN(CC2)C2=C(N=CC(=N2)C(=O)O)NC(C)C)C=CC(=C1)F
6-(4-(2,4-difluorophenoxy)piperidin-1-yl)-5-(isopropylamino)pyrazine-2-carboxylic acid; CAS No.: 1803121-23-4. ChemShuttle operates as a custom chemical synthesis companies, offering specialized building blocks like 6-(4-(2,4-difluorophenoxy)piperidin-1-yl)-5-(isopropylamino)pyrazine-2-carboxylic acid. These products are crucial for medicinal chemistry and preclinical studies, providing researchers with high-purity intermediates. The company excels in CRO chemical synthesis, collaborating with clients to develop tailored solutions for complex molecular challenges. Their expertise ensures efficient synthesis and rigorous quality control.
Reviews
Write Your Own Review