5-(tert-butoxycarbonylamino)pyrazine-2-carboxylic acid
$200.00
CAS No.: 891782-63-1
Catalog No.: 101387
Purity: 95%
MF: C10H13N3O4
MW: 239.231
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)NC1=CN=C(C=N1)C(O)=O
Catalog No.: 101387
Purity: 95%
MF: C10H13N3O4
MW: 239.231
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)NC1=CN=C(C=N1)C(O)=O
5-(tert-butoxycarbonylamino)pyrazine-2-carboxylic acid; CAS No.: 891782-63-1; 5-(tert-butoxycarbonylamino)pyrazine-2-carboxylic acid represents ChemShuttle's pharma building blocks. This protected amine derivative is valuable in peptide synthesis and drug development. As a custom chemical synthesis company, ChemShuttle provides this compound with strict quality control. The Boc protection group allows for controlled deprotection during synthesis sequences. ChemShuttle's small molecules synthesis expertise ensures proper handling of such sensitive compounds. Researchers benefit from accessing this building block to construct complex pharmaceutical molecules with precise functionality.
Reviews
Write Your Own Review