3-(2,3-dichlorophenyl)-6-iodopyrazin-2-amine
$240.00
CAS No.: 2119574-67-1
Catalog No.: 151033
Purity: 95%
MF: C10H6Cl2IN3
MW: 365.989
Storage: 2-8 degree Celsius
SMILES: NC1=C(N=CC(I)=N1)C1=C(Cl)C(Cl)=CC=C1
Catalog No.: 151033
Purity: 95%
MF: C10H6Cl2IN3
MW: 365.989
Storage: 2-8 degree Celsius
SMILES: NC1=C(N=CC(I)=N1)C1=C(Cl)C(Cl)=CC=C1
3-(2,3-dichlorophenyl)-6-iodopyrazin-2-amine; CAS No.: 2119574-67-1; This chemical is essential in the development of novel therapeutic agents. Its advantages include high stability and reactivity, making it suitable for custom synthesis and process chemistry. ChemShuttle provides FTE, custom synthesis, and process chemistry services, supporting CRO chemical synthesis with over 80,000 products. Online purchasing and US warehouse shipping are offered.
Reviews
Write Your Own Review