4-(4-fluoro-phenyl)-tetrahydro-pyran-4-carboxylic acid
$300.00
CAS No.: 473706-11-5
Catalog No.: 109294
Purity: 95%
MF: C12H13FO3
MW: 224.231
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1(CCOCC1)C1=CC=C(F)C=C1
Catalog No.: 109294
Purity: 95%
MF: C12H13FO3
MW: 224.231
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1(CCOCC1)C1=CC=C(F)C=C1
4-(4-fluoro-phenyl)-tetrahydro-pyran-4-carboxylic acid; CAS No.: 473706-11-5; 4-(4-fluoro-phenyl)-tetrahydro-pyran-4-carboxylic acid is categorized under ChemShuttle's key intermediates product line. This classification emphasizes its role as a crucial component in the synthesis of more complex chemical compounds. As a key intermediate, this fluoro-substituted pyran derivative provides researchers with a reliable starting material that can be utilized in various synthetic transformations. ChemShuttle's offering of key intermediates like 4-(4-fluoro-phenyl)-tetrahydro-pyran-4-carboxylic acid reflects the company's commitment to supplying essential building materials for chemical research. The compound's CAS No.: 473706-11-5 allows for precise identification and selection among other key intermediates. By maintaining a comprehensive inventory of key intermediates, ChemShuttle supports the efficient progression of research projects, enabling scientists to build upon these foundations to create innovative compounds for diverse applications.
Reviews
Write Your Own Review