tert-butyl (3R,4S)-3-fluoro-4-hydroxypiperidine-1-carboxylate
$195.00
CAS No.: 1174020-42-8
Catalog No.: 171551
Purity: 95%
MF: C10H18FNO3
MW: 219.256
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CC[C@H](O)[C@H](F)C1
Catalog No.: 171551
Purity: 95%
MF: C10H18FNO3
MW: 219.256
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CC[C@H](O)[C@H](F)C1
For R&D use only. Not for human or animal use.
tert-butyl (3R,4S)-3-fluoro-4-hydroxypiperidine-1-carboxylate; CAS No.: 1174020-42-8; tert-butyl (3R,4S)-3-fluoro-4-hydroxypiperidine-1-carboxylate is a cycle compound offered by ChemShuttle, a chemical synthesis company. It serves as a key intermediate in small molecules synthesis, contributing to the construction of more complex molecular architectures. This compound is essential for creating molecules with specific functions, which is important for both academic research and industrial chemical production.
Reviews
Write Your Own Review