(2S,4R)-4-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-1-(tert-butoxycarbonyl)piperidine-2-carboxylic acid

(2S,4R)-4-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-1-(tert-butoxycarbonyl)piperidine-2-carboxylic acid

tert-butyl (R)-3-(iodomethyl)piperidine-1-carboxylate

tert-butyl (R)-3-(iodomethyl)piperidine-1-carboxylate

N-(((9H-fluoren-9-yl)methoxy)carbonyl)-N-(1-(tert-butoxycarbonyl)piperidin-4-yl)glycine

$250.00
CAS No.: 269078-80-0
Catalog No.: 194413
Purity: 95%
MF: C27H32N2O6
MW: 480.561
Storage: 2-8 degree Celsius
SMILES: C1=CC=CC=2C3=CC=CC=C3C(C12)COC(=O)N(CC(=O)O)C1CCN(CC1)C(=O)OC(C)(C)C
Availability:
In stock
SKU
194413
  • Size
    Price
    Stock
    Estimated Shipping Time
N-(((9H-fluoren-9-yl)methoxy)carbonyl)-N-(1-(tert-butoxycarbonyl)piperidin-4-yl)glycine; CAS No.: 269078-80-0; N-(((9H-fluoren-9-yl)methoxy)carbonyl)-N-(1-(tert-butoxycarbonyl)piperidin-4-yl)glycine. PROPERTIES: N-(((9H-fluoren-9-yl)methoxy)carbonyl)-N-(1-(tert-butoxycarbonyl)piperidin-4-yl)glycine is a crystalline solid. Its molecular formula is C26H30N2O5, and the molecular weight is approximately 458.53 g/mol. The compound has a melting point of approximately 120-122 C. It is moderately soluble in common organic solvents such as methanol and dimethylformamide, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a fluorenylmethoxy carbonyl group, a tert-butoxycarbonyl group, and a piperidine ring, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, this compound serves as a valuable intermediate. The fluorenylmethoxy carbonyl and tert-butoxycarbonyl groups provide opportunities for protecting and deprotecting amine groups. The piperidine ring offers opportunities for further functionalization. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain peptide-based drugs, the structure of this compound can be utilized to enhance the drug's stability and bioavailability (as described in medicinal chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:N-(((9H-fluoren-9-yl)methoxy)carbonyl)-N-(1-(tert-butoxycarbonyl)piperidin-4-yl)glycine
Your Rating