ethyl 2-(4-(tert-butoxycarbonyl)piperazin-1-yl)thiazole-4-carboxylate
$250.00
CAS No.: 867065-53-0
Catalog No.: 138322
Purity: 95%
MF: C15H23N3O4S
MW: 341.433
Storage: 2-8 degree Celsius
SMILES: CCOC(=O)C1=CSC(=N1)N1CCN(CC1)C(=O)OC(C)(C)C
Catalog No.: 138322
Purity: 95%
MF: C15H23N3O4S
MW: 341.433
Storage: 2-8 degree Celsius
SMILES: CCOC(=O)C1=CSC(=N1)N1CCN(CC1)C(=O)OC(C)(C)C
ethyl 2-(4-(tert-butoxycarbonyl)piperazin-1-yl)thiazole-4-carboxylate; CAS No.:867065-53-0; ethyl 2-(4-(tert-butoxycarbonyl)piperazin-1-yl)thiazole-4-carboxylate. ChemShuttle, a custom synthesis company, offers various custom compound synthesis services. The compound ethyl 2 - (4 - (tert - butoxycarbonyl)piperazin - 1 - yl)thiazole - 4 - carboxylate (CAS No.:867065-53-0) can be synthesized through custom compound synthesis. Custom compound synthesis allows for the production of specific chemicals according to individual requirements. ChemShuttle's synthesis team is capable of handling various complex synthesis tasks to meet different research and industrial needs.
Reviews
Write Your Own Review