Benzyl 3-(hydroxymethyl)piperazine-1-carboxylate
$200.00
CAS No.: 191739-40-9
Catalog No.: 138330
Purity: 95%
MF: C13H18N2O3
MW: 250.298
Storage: 2-8 degree Celsius
SMILES: OCC1CN(CCN1)C(=O)OCC1=CC=CC=C1
Catalog No.: 138330
Purity: 95%
MF: C13H18N2O3
MW: 250.298
Storage: 2-8 degree Celsius
SMILES: OCC1CN(CCN1)C(=O)OCC1=CC=CC=C1
Benzyl 3-(hydroxymethyl)piperazine-1-carboxylate; CAS No.:191739-40-9; Benzyl 3-(hydroxymethyl)piperazine-1-carboxylate. ChemShuttle, a chemical synthesis company, provides various building blocks. The compound Benzyl 3 - (hydroxymethyl)piperazine - 1 - carboxylate (CAS No.:191739-40-9) is one of the building blocks. It can be used in the synthesis of various organic compounds. Building blocks are fundamental units that can be combined to create new molecules with specific properties. ChemShuttle's building blocks collection is extensive and diverse to support various research and industrial applications.
Reviews
Write Your Own Review