2-(4-(tert-butoxycarbonyl)piperazin-1-yl)acetic acid
$395.00
CAS No.: 156478-71-6
Catalog No.: 111517
Purity: 95%
MF: C11H20N2O4
MW: 244.291
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCN(CC(O)=O)CC1
Catalog No.: 111517
Purity: 95%
MF: C11H20N2O4
MW: 244.291
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCN(CC(O)=O)CC1
2-(4-(tert-butoxycarbonyl)piperazin-1-yl)acetic acid; CAS No.: 156478-71-6; 2-(4-(tert-Butoxycarbonyl)piperazin-1-yl)acetic acid, a Boc-protected piperazine acetic acid, is part of our pharma building blocks for peptide-mimetic drug design. As a worldwide chemical supplier, we deliver this zwitterionic compound for linker chemistry in PROTACs and antibody-drug conjugates. The Boc group enables selective deprotection, while the acetic acid moiety facilitates conjugation. ChemShuttle s custom synthesis services ensure precise control over protecting group strategies, supporting complex molecular architectures in targeted therapy development.
Reviews
Write Your Own Review