2-(4-methylpiperazin-1-yl)-5-nitrobenzonitrile
$150.00
CAS No.: 451459-92-0
Catalog No.: 138431
Purity: 95%
MF: C12H14N4O2
MW: 246.27
Storage: 2-8 degree Celsius
SMILES: CN1CCN(CC1)C1=C(C=C(C=C1)[N+]([O-])=O)C#N
Catalog No.: 138431
Purity: 95%
MF: C12H14N4O2
MW: 246.27
Storage: 2-8 degree Celsius
SMILES: CN1CCN(CC1)C1=C(C=C(C=C1)[N+]([O-])=O)C#N
2-(4-methylpiperazin-1-yl)-5-nitrobenzonitrile; CAS No.:451459-92-0; 2-(4-methylpiperazin-1-yl)-5-nitrobenzonitrile. As a custom synthesis company, ChemShuttle offers various custom compound synthesis services. The compound 2 - (4 - methylpiperazin - 1 - yl) - 5 - nitrobenzonitrile (CAS No.:451459-92-0) can be synthesized through custom compound synthesis. Custom compound synthesis allows for the production of specific chemicals according to individual requirements. ChemShuttle's synthesis team is skilled and experienced in handling various complex synthesis tasks to meet different research and industrial demands.
Reviews
Write Your Own Review