diethyl (6-phenylphenanthridine-3,8-diyl)dicarbamate
$300.00
CAS No.: 62895-39-0
Catalog No.: 194540
Purity: 95%
MF: C25H23N3O4
MW: 429.476
Storage: 2-8 degree Celsius
SMILES: O=C(OCC)NC1=CC2=C(C3=CC=CC=C3)N=C4C(C=CC(NC(OCC)=O)=C4)=C2C=C1
Catalog No.: 194540
Purity: 95%
MF: C25H23N3O4
MW: 429.476
Storage: 2-8 degree Celsius
SMILES: O=C(OCC)NC1=CC2=C(C3=CC=CC=C3)N=C4C(C=CC(NC(OCC)=O)=C4)=C2C=C1
diethyl (6-phenylphenanthridine-3,8-diyl)dicarbamate; CAS No.: 62895-39-0; diethyl (6-phenylphenanthridine-3,8-diyl)dicarbamate. PROPERTIES: diethyl (6-phenylphenanthridine-3,8-diyl)dicarbamate is a crystalline solid. Its molecular formula is C24H22N2O4, and the molecular weight is approximately 402.44 g/mol. The compound has a melting point of approximately 120-122 C. It is moderately soluble in common organic solvents such as methanol and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a phenanthridine ring, two carbamate groups, and a phenyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, diethyl (6-phenylphenanthridine-3,8-diyl)dicarbamate serves as a versatile intermediate. The carbamate groups can undergo hydrolysis to form amine groups. The phenanthridine ring provides unique electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of diethyl (6-phenylphenanthridine-3,8-diyl)dicarbamate can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).
Reviews
Write Your Own Review