(S)-N-(2-(4-Isopropyl-4,5-dihydrooxazol-2-yl)-6-methylphenyl)methanesulfonamide
$300.00
CAS No.: 480444-15-3
Catalog No.: 197902
Purity: 95%
MF: C14H20N2O3S
MW: 296.392
Storage: 2-8 degree Celsius
SMILES: C(C)(C)[C@@H]1N=C(OC1)C1=C(C(=CC=C1)C)NS(=O)(=O)C
Catalog No.: 197902
Purity: 95%
MF: C14H20N2O3S
MW: 296.392
Storage: 2-8 degree Celsius
SMILES: C(C)(C)[C@@H]1N=C(OC1)C1=C(C(=CC=C1)C)NS(=O)(=O)C
CAS No.: 480444-15-3; ChemShuttle offers chemical building blocks such as (S)-N-(2-(4-Isopropyl-4,5-dihydrooxazol-2-yl)-6-methylphenyl)methanesulfonamide for chiral synthesis. This chemical building block, with CAS No. 480444-15-3, is essential for asymmetric catalysis. As chemical building blocks, they provide foundational elements. The CAS 480444-15-3 references this compound. Chemical building blocks enable efficient drug design.
Reviews
Write Your Own Review