5-(chloromethyl)-3-(2-methylphenyl)-1,2,4-oxadiazole
$600.00
CAS No.: 60580-24-7
Catalog No.: 134029
Purity: 95%
MF: C10H9ClN2O
MW: 208.648
Storage: 2-8 degree Celsius
SMILES: CC1=C(C=CC=C1)C1=NOC(CCl)=N1
Catalog No.: 134029
Purity: 95%
MF: C10H9ClN2O
MW: 208.648
Storage: 2-8 degree Celsius
SMILES: CC1=C(C=CC=C1)C1=NOC(CCl)=N1
5-(chloromethyl)-3-(2-methylphenyl)-1,2,4-oxadiazole; CAS No.: 60580-24-7; 5-(chloromethyl)-3-(2-methylphenyl)-1,2,4-oxadiazole is categorized under chemical building blocks, playing a significant role in the synthesis of more complex molecules. As a chemical synthesis company, ChemShuttle provides access to this compound, facilitating the creation of new substances with potential applications in drug discovery and material science. The company's custom synthesis capabilities allow for the production of CAS No.: 60580-24-7; 5-(chloromethyl)-3-(2-methylphenyl)-1,2,4-oxadiazole to meet specific research requirements. With a strong emphasis on building blocks for drug discovery, ChemShuttle's diverse portfolio includes this oxadiazole derivative, which is essential for constructing novel pharmaceutical agents. The company's status as a worldwide chemical supplier ensures that researchers can obtain this compound efficiently, supporting their scientific endeavors.
Reviews
Write Your Own Review