[3-(4-methoxy-phenyl)-isoxazol-5-yl]-methanol
$300.00
CAS No.: 206055-86-9
Catalog No.: 109084
Purity: 95%
MF: C11H11NO3
MW: 205.213
Storage: 2-8 degree Celsius
SMILES: COC1=CC=C(C=C1)C1=NOC(CO)=C1
Catalog No.: 109084
Purity: 95%
MF: C11H11NO3
MW: 205.213
Storage: 2-8 degree Celsius
SMILES: COC1=CC=C(C=C1)C1=NOC(CO)=C1
[3-(4-methoxy-phenyl)-isoxazol-5-yl]-methanol; CAS No.: 206055-86-9; [3-(4-methoxy-phenyl)-isoxazol-5-yl]-methanol is included in ChemShuttle's Small molecules synthesis offerings. This product exemplifies the company's capability to produce specialized small molecules for research purposes. As part of Small molecules synthesis, this compound is manufactured with attention to the precise molecular structure and purity required for scientific studies. ChemShuttle's Small molecules synthesis services ensure that compounds like [3-(4-methoxy-phenyl)-isoxazol-5-yl]-methanol meet the exact specifications needed by researchers. The product's CAS No.: 206055-86-9 allows scientists to accurately source this specific small molecule. By focusing on Small molecules synthesis, ChemShuttle supports advancements in fields such as medicinal chemistry, where the activity and properties of small molecules are critical. Researchers can rely on ChemShuttle to supply high-quality [3-(4-methoxy-phenyl)-isoxazol-5-yl]-methanol that adheres to their experimental requirements, facilitating the exploration of biological targets and chemical reactions.
Reviews
Write Your Own Review