2-methyl-5-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,4-oxadiazole
$250.00
CAS No.: 1056456-24-6
Catalog No.: 171701
Purity: 95%
MF: C15H19BN2O3
MW: 286.14
Storage: 2-8 degree Celsius
SMILES: CC1=NN=C(O1)C1=CC=C(C=C1)B1OC(C)(C)C(C)(C)O1
Catalog No.: 171701
Purity: 95%
MF: C15H19BN2O3
MW: 286.14
Storage: 2-8 degree Celsius
SMILES: CC1=NN=C(O1)C1=CC=C(C=C1)B1OC(C)(C)C(C)(C)O1
2-methyl-5-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,4-oxadiazole; CAS No.: 1056456-24-6; 2-methyl-5-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,4-oxadiazole is a heterocycle and a key intermediate. As a product from ChemShuttle, a leading chemicals distributor, it can be used in custom synthesis processes. The heterocyclic oxadiazole structure with the methyl, phenyl, and boronate functional groups provides a reactive platform for creating more complex molecules. In drug discovery, it can serve as a crucial starting point for developing compounds with potential therapeutic effects. ChemShuttle's custom synthesis capabilities assist in modifying and building upon this structure to create new chemical entities with desired properties.
Reviews
Write Your Own Review