DOTA

DOTA

tert-butyl 1,5-diazocane-1-carboxylate

tert-butyl 1,5-diazocane-1-carboxylate

N-((3aR,4S,7S,8R,8aR)-4-(hydroxymethyl)-2,2-dimethylhexahydro-4,7-epoxy[1,3]dioxolo[4,5-d]oxepin-8-yl)acetamide

$1,200.00
CAS No.: 1824718-03-7
Catalog No.: 194450
Purity: 95%
MF: C12H19NO6
MW: 273.285
Storage: 2-8 degree Celsius
SMILES: OC[C@@]12[C@H]3[C@@H]([C@H]([C@@H](OC1)O2)NC(C)=O)OC(O3)(C)C
Availability:
In stock
SKU
194450
  • Size
    Price
    Stock
    Estimated Shipping Time
N-((3aR,4S,7S,8R,8aR)-4-(hydroxymethyl)-2,2-dimethylhexahydro-4,7-epoxy[1,3]dioxolo[4,5-d]oxepin-8-yl)acetamide; CAS No.: 1824718-03-7; N-((3aR,4S,7S,8R,8aR)-4-(hydroxymethyl)-2,2-dimethylhexahydro-4,7-epoxy[1,3]dioxolo[4,5-d]oxepin-8-yl)acetamide. PROPERTIES: N-((3aR,4S,7S,8R,8aR)-4-(hydroxymethyl)-2,2-dimethylhexahydro-4,7-epoxy[1,3]dioxolo[4,5-d]oxepin-8-yl)acetamide is a crystalline solid. Its molecular formula is C12H20N2O5, and the molecular weight is approximately 276.29 g/mol. The compound has a melting point of approximately 100-102 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an oxepine ring, a hydroxymethyl group, and an amide group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, this compound serves as a specialized intermediate. The hydroxymethyl group can undergo reactions such as etherification and esterification. The amide group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antimicrobial agents, the structure of this compound can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:N-((3aR,4S,7S,8R,8aR)-4-(hydroxymethyl)-2,2-dimethylhexahydro-4,7-epoxy[1,3]dioxolo[4,5-d]oxepin-8-yl)acetamide
Your Rating