![2-amino-6-(((5aR,6R)-1,7-dioxo-1,3,4,5a,6,7-hexahydroazeto[2,1-b]furo[3,4-d][1,3]thiazin-6-yl)amino)-6-oxohexanoic acid](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/9/199551_1.jpg)
methyl 5-formylselenophene-2-carboxylate
$1,200.00
CAS No.: 1252925-62-4
Catalog No.: 199199
Purity: 95%
MF: C7H6O3Se
MW: 217.082
Storage: 2-8 degree Celsius
SMILES: C(=O)C1=CC=C([Se]1)C(=O)OC
Catalog No.: 199199
Purity: 95%
MF: C7H6O3Se
MW: 217.082
Storage: 2-8 degree Celsius
SMILES: C(=O)C1=CC=C([Se]1)C(=O)OC
CAS No.: 1252925-62-4; methyl 5-formylselenophene-2-carboxylate is part of ChemShuttle's pharma building blocks inventory. This compound offers unique electronic properties that make it valuable for constructing novel pharmaceutical agents. As a chemical blocks supplier, ChemShuttle provides this CAS 1252925-62-4 compound through their online platform, connecting researchers with essential chemical resources. The selenophene moiety and formyl group enhance the compound's reactivity and bioavailability profiles, making it particularly useful in modern drug discovery. ChemShuttle's process chemistry expertise ensures consistent production of high-quality compounds like this one. Researchers can incorporate the CAS 1252925-62-4 building block into diverse synthetic pathways, benefiting from ChemShuttle's efficient distribution network and commitment to quality.
Reviews
Write Your Own Review