4,8-dichloro-1,7-naphthyridine
$450.00
CAS No.: 1279894-03-9
Catalog No.: ZB0104
Purity: 95%
MF: C8H4Cl2N2
MW: 199.04
Storage: 2-8 degree Celsius
SMILES: ClC1=CC=NC2=C(N=CC=C12)Cl
Catalog No.: ZB0104
Purity: 95%
MF: C8H4Cl2N2
MW: 199.04
Storage: 2-8 degree Celsius
SMILES: ClC1=CC=NC2=C(N=CC=C12)Cl
4,8-dichloro-1,7-naphthyridine; CAS No.: 1279894-03-9; 4,8-dichloro-1,7-naphthyridine showcases ChemShuttle's strength in dichlorinated naphthyridine derivatives for their screening compounds library. As a custom chemical synthesis company providing CRO chemical synthesis services, ChemShuttle produces these aryl chloride-containing structures essential for cross-coupling reactions in drug discovery. The 4,8-dichloro substitution offers valuable handles for further modification and bioconjugation. Their role as a Leading Chemicals Distributor ensures reliable supply of these enabling intermediates. ChemShuttle's expertise in producing halogenated heterocycles ensures that researchers can obtain materials of sufficient quality for both early discovery and more advanced medicinal chemistry efforts.
Reviews
Write Your Own Review