3-bromo-6-methoxy-1,8-naphthyridine
$400.00
CAS No.: 2225879-19-4
Catalog No.: 192186
Purity: 95%
MF: C9H7BrN2O
MW: 239.072
Storage: 2-8 degree Celsius
SMILES: BrC=1C=NC2=NC=C(C=C2C1)OC
Catalog No.: 192186
Purity: 95%
MF: C9H7BrN2O
MW: 239.072
Storage: 2-8 degree Celsius
SMILES: BrC=1C=NC2=NC=C(C=C2C1)OC
3-bromo-6-methoxy-1,8-naphthyridine; CAS No.: 2225879-19-4; 3-bromo-6-methoxy-1,8-naphthyridine. PROPERTIES: 3-bromo-6-methoxy-1,8-naphthyridine is a light-sensitive compound appearing as a yellow crystalline solid. It has a molecular weight of 257.07 g/mol and a melting point around 102-105 C. The compound shows limited solubility in water but dissolves well in polar aprotic solvents. Recommended storage involves amber glass bottles, protection from light, and temperatures below 20 C. Safety considerations include avoiding skin contact and using explosion-proof equipment during handling due to its flammability and potential to cause skin irritation. APPLICATIONS: This brominated naphthyridine derivative is particularly valuable in medicinal chemistry for creating targeted anticancer agents. The bromine substituent provides a site for palladium-catalyzed cross-coupling reactions as detailed in organic chemistry textbooks. The methoxy group donates electron density to the naphthyridine core, enhancing its ability to intercalate with DNA. According to cancer research publications, derivatives of 3-bromo-6-methoxy-1,8-naphthyridine have demonstrated topo-isomerase II inhibition properties. Additionally, the compound serves as a fluorescent marker in nucleic acid studies due to the naphthyridine scaffold's natural fluorescence.
Reviews
Write Your Own Review