•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Naphthyridines

Set Descending Direction

   

Items 1 to 10 of 192 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 6-(tert-butoxycarbonyl)-2-methoxy-5,6,7,8-tetrahydro-1,6-naphthyridine-5-carboxylic acid

    CAS No.: 1644237-02-4
    Catalog No.: TQ0148
    Purity: 95%
    MF: C15H20N2O5
    MW: 308.334
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N1C(C=2C=CC(=NC2CC1)OC)C(=O)O
  2. (E)-1-cyclopropyl-6-fluoro-7-(8-(methoxyimino)-2,6-diazaspiro[3.4]octan-6-yl)-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid

    CAS No.: 219680-11-2
    Catalog No.: TQP0864
    Purity: 95%
    MF: C19H20FN5O4
    MW: 401.398
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)N1C=C(C(C2=CC(=C(N=C12)N1CC2(CNC2)\C(\C1)=N/OC)F)=O)C(=O)O
  3. 8-chloro-3-methyl-1,7-naphthyridin-2(1H)-one

    CAS No.: 1801158-62-2
    Catalog No.: TQP0939
    Purity: 95%
    MF: C9H7ClN2O
    MW: 194.621
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=CC=C2C=C(C(NC12)=O)C
  4. methyl 2-(4-bromophenyl)-3-methyl-6-(trifluoromethyl)-1,7-naphthyridine-4-carboxylate

    CAS No.: 2230617-42-0
    Catalog No.: TQR0590
    Purity: 95%
    MF: C18H12BrF3N2O2
    MW: 425.204
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C1=NC2=CN=C(C=C2C(=C1C)C(=O)OC)C(F)(F)F
  5. 2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethanol

    CAS No.: 243641-39-6
    Catalog No.: TQR1129
    Purity: 95%
    MF: C10H14N2O
    MW: 178.235
    Storage: 2-8 degree Celsius
    SMILES: N1=C(C=CC=2CCCNC12)CCO
  6. tert-butyl 7-(2-hydroxyethyl)-3,4-dihydro-1,8-naphthyridine-1(2H)-carboxylate

    CAS No.: 445490-78-8
    Catalog No.: TQR1130
    Purity: 95%
    MF: C15H22N2O3
    MW: 278.352
    Storage: 2-8 degree Celsius
    SMILES: OCCC1=CC=C2CCCN(C2=N1)C(=O)OC(C)(C)C
  7. 2-(benzyloxy)-8-chloro-3-methyl-1,7-naphthyridine

    CAS No.: 1801158-63-3
    Catalog No.: TQR1211
    Purity: 95%
    MF: C16H13ClN2O
    MW: 284.746
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)OC1=NC2=C(N=CC=C2C=C1C)Cl
  8. 3-bromo-8-chloro-1,5-naphthyridine

    CAS No.: 97267-61-3
    Catalog No.: 112302
    Purity: 95%
    MF: C8H4BrClN2
    MW: 243.491
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2N=CC(Br)=CC2=NC=C1
  9. 1,7-naphthyridin-8-amine

    CAS No.: 17965-82-1
    Catalog No.: 134349
    Purity: 95%
    MF: C8H7N3
    MW: 145.165
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=CC2=CC=CN=C12
  10. 6-bromo-3,4-dihydro-1H-[1,8]naphthyridin-2-one

    CAS No.: 129686-16-4
    Catalog No.: 136882
    Purity: 95%
    MF: C8H7BrN2O
    MW: 227.061
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CN=C2NC(=O)CCC2=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 192 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5