4-tert-butyl 2-methyl morpholine-2,4-dicarboxylate
$200.00
CAS No.: 500789-41-3
Catalog No.: 138522
Purity: 95%
MF: C11H19NO5
MW: 245.275
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1CN(CCO1)C(=O)OC(C)(C)C
Catalog No.: 138522
Purity: 95%
MF: C11H19NO5
MW: 245.275
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1CN(CCO1)C(=O)OC(C)(C)C
4-tert-butyl 2-methyl morpholine-2,4-dicarboxylate; CAS No.:500789-41-3; 4-tert-butyl 2-methyl morpholine-2,4-dicarboxylate. As a custom synthesis company, ChemShuttle offers various custom compound synthesis services. The compound 4 - tert - butyl 2 - methyl morpholine - 2,4 - dicarboxylate (CAS No.:500789-41-3) can be synthesized through custom compound synthesis. Custom compound synthesis allows for the production of specific chemicals according to individual requirements. ChemShuttle's synthesis team is skilled and experienced in handling various complex synthesis tasks to meet different research and industrial demands.
Reviews
Write Your Own Review