(3-Morpholinophenyl)boronic acid hydrochloride
$300.00
CAS No.: 863248-20-8
Catalog No.: 138706
Purity: 95%
MF: C10H15BClNO3
MW: 243.499
Storage: 2-8 degree Celsius
SMILES: Cl.OB(O)C1=CC(=CC=C1)N1CCOCC1
Catalog No.: 138706
Purity: 95%
MF: C10H15BClNO3
MW: 243.499
Storage: 2-8 degree Celsius
SMILES: Cl.OB(O)C1=CC(=CC=C1)N1CCOCC1
(3-Morpholinophenyl)boronic acid hydrochloride; CAS No.:863248-20-8; (3-Morpholinophenyl)boronic acid hydrochloride. As a custom synthesis company, ChemShuttle offers various custom compound synthesis services. The compound (3 - Morpholinophenyl)boronic acid hydrochloride (CAS No.:863248-20-8) can be synthesized through custom compound synthesis. Custom compound synthesis allows for the production of specific chemicals according to individual requirements. ChemShuttle's synthesis team is skilled and experienced in handling various complex synthesis tasks to meet different research and industrial demands.
Reviews
Write Your Own Review